Molecule Details
| InChIKey | NTJOBXMMWNYJFB-UHFFFAOYSA-N |
|---|---|
| Compound Name | Amisulpride |
| Canonical SMILES | CCN1CCCC1CNC(=O)c1cc(S(=O)(=O)CC)c(N)cc1OC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.59 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB06288 |
|---|---|
| Drug Name | Amisulpride |
| CAS Number | 71675-85-9 |
| Groups | approved investigational |
| ATC Codes | N05AL05 |
| Description | Amisulpride is a benzamide derivative and a dopamine receptor antagonist that selectively works on dopamine D2 and D3 receptors. As an antipsychotic agent, amisulpride alleviates both positive and negative symptoms of schizophrenia, and it exhibits antidepressant properties in patients with psychiat... |
Categories: Acids, Carbocyclic Amides Antidepressive Agents Antidepressive Agents, Second-Generation Antiemetics Antipsychotic Agents Antipsychotic Agents (Second Generation [Atypical]) BCRP/ABCG2 Substrates Benzamides and benzamide derivatives Benzene Derivatives Benzoates Central Nervous System Agents Central Nervous System Depressants Dopamine Agents Dopamine Antagonists Dopamine D2 Receptor Antagonists MATE 1 Inhibitors MATE 1 Substrates MATE 2 Inhibitors MATE 2 Substrates MATE inhibitors MATE substrates Nervous System Neurotoxic agents Neurotransmitter Agents OCT1 substrates Opioid Agonist P-glycoprotein substrates Potential QTc-Prolonging Agents Psycholeptics Psychotropic Drugs QTc Prolonging Agents Serotonin 5-HT2 Receptor Antagonists Serotonin 5-HT2A Receptor Antagonists Serotonin Agents Serotonin Receptor Antagonists Tranquilizing Agents
Cross-references: BindingDB: 81790 ChEBI: 64045 CHEMBL243712 ChemSpider: 2074 Guide to Pharmacology: 963 IUPHAR: 963 D07310 PharmGKB: PA162565877 PubChem:2159 PubChem:99443244 RxCUI: 46303 Therapeutic Targets Database: DAP000848 Wikipedia: Amisulpride
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 8.5 | IC50 | ChEMBL;BindingDB |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 8.4 | Ki | ChEMBL;BindingDB |
| P34969 | HTR7 | Homo sapiens | Human | PF00001 | 7.6 | Ki | ChEMBL;BindingDB |
| P41595 | HTR2B | Homo sapiens | Human | PF00001 | 7.2 | Ki | ChEMBL;BindingDB |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 6.2 | Ki | ChEMBL;BindingDB |
DrugBank Target Actions (14)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P35372 | OPRM1 | Mu-type opioid receptor | agonist | targets |
| P41143 | OPRD1 | Delta-type opioid receptor | agonist | targets |
| P41145 | OPRK1 | Kappa-type opioid receptor | agonist | targets |
| P14416 | DRD2 | D(2) dopamine receptor | antagonist | targets |
| P28223 | HTR2A | 5-hydroxytryptamine receptor 2A | antagonist | targets |
| P34969 | HTR7 | 5-hydroxytryptamine receptor 7 | antagonist | targets |
| P35462 | DRD3 | D(3) dopamine receptor | antagonist | targets |
| Q86VL8 | SLC47A2 | Multidrug and toxin extrusion protein 2 | inhibitor | transporters |
| Q96FL8 | SLC47A1 | Multidrug and toxin extrusion protein 1 | inhibitor | transporters |
| O15245 | SLC22A1 | Solute carrier family 22 member 1 | substrate | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |
| Q86VL8 | SLC47A2 | Multidrug and toxin extrusion protein 2 | substrate | transporters |
| Q96FL8 | SLC47A1 | Multidrug and toxin extrusion protein 1 | substrate | transporters |
| Q9UNQ0 | ABCG2 | Broad substrate specificity ATP-binding cassette transporter ABCG2 | substrate | transporters |