Molecule Details
| InChIKey | NSQSAUGJQHDYNO-UHFFFAOYSA-N |
|---|---|
| Compound Name | Tazemetostat |
| Canonical SMILES | CCN(c1cc(-c2ccc(CN3CCOCC3)cc2)cc(C(=O)NCc2c(C)cc(C)[nH]c2=O)c1C)C1CCOCC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.09 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12887 |
|---|---|
| Drug Name | Tazemetostat |
| CAS Number | 1403254-99-8 |
| Groups | approved investigational |
| ATC Codes | L01XX72 |
| Description | Tazemetostat is a methyltransferase inhibitor used to treat metastatic or locally advanced epithelioid sarcoma not eligible for complete resection.[L11476] Tazemetostat was first named in literature as EPZ-6438.[A190363] Tazemetaostat was granted FDA approval on 23 January 2020.[L11476] |
Categories: Amides Antineoplastic Agents Antineoplastic and Immunomodulating Agents BCRP/ABCG2 Substrates Benzene Derivatives Benzoates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A4 Substrates (strength unknown) Cytochrome P-450 Substrates MATE 1 Inhibitors MATE 2 Inhibitors MATE 2-K Inhibitors MATE inhibitors Methyltransferase Inhibitor Methyltransferase Inhibitors Oxazines P-glycoprotein substrates Pyridines
Cross-references: BindingDB: 172038 CHEMBL3414621 ChemSpider: 30208713 PubChem:66558664 PubChem:347829042 RxCUI: 2274378 Wikipedia: Tazemetostat ZINC: ZINC000100285161
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| O75530 | EED | Homo sapiens | Human | PF00400 | 8.4 | IC50 | ChEMBL;BindingDB |
| Q09028 | RBBP4 | Homo sapiens | Human | PF12265 PF00400 | 8.4 | IC50 | ChEMBL |
| Q15022 | SUZ12 | Homo sapiens | Human | PF09733 PF23320 | 8.4 | IC50 | ChEMBL |
| Q6ZN18 | AEBP2 | Homo sapiens | Human | PF26014 | 8.4 | IC50 | ChEMBL |
| Q15910 | EZH2 | Homo sapiens | Human | PF21358 PF11616 PF18118 PF18264 PF00856 | 8.1 | IC50 | ChEMBL;BindingDB |
| Q92800 | EZH1 | Homo sapiens | Human | PF21358 PF11616 PF18118 PF18264 PF00856 | 6.8 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (7)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08684 | CYP3A4 | Cytochrome P450 3A Subfamily | substrate | enzymes |
| Q15910 | EZH2 | Histone-lysine N-methyltransferase EZH2 | inhibitor | targets |
| Q92800 | EZH1 | Histone-lysine N-methyltransferase EZH1 | inhibitor | targets |
| Q86VL8 | SLC47A2 | Multidrug and toxin extrusion protein 2 | inhibitor | transporters |
| Q96FL8 | SLC47A1 | Multidrug and toxin extrusion protein 1 | inhibitor | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |
| Q9UNQ0 | ABCG2 | Broad substrate specificity ATP-binding cassette transporter ABCG2 | substrate | transporters |