Molecule Details
| InChIKey | NRPQELCNMADTOZ-OAQYLSRUSA-N |
|---|---|
| Compound Name | Lecozotan |
| Canonical SMILES | C[C@H](CN(C(=O)c1ccc(C#N)cc1)c1ccccn1)N1CCN(c2cccc3c2OCCO3)CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.16 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12540 |
|---|---|
| Drug Name | Lecozotan |
| CAS Number | 434283-16-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Lecozotan has been used in trials studying the treatment of Alzheimer Disease. |
Categories: Antidepressive Agents Central Nervous System Depressants Serotonin 5-HT1 Receptor Antagonists Serotonin 5-HT1A Receptor Antagonists Serotonin Agents Serotonin Receptor Antagonists
Cross-references: BindingDB: 50166903 CHEMBL372205 ChemSpider: 8292400 PubChem:10116877 PubChem:347828766 Wikipedia: Lecozotan