Molecule Details
| InChIKey | NPFDWHQSDBWQLH-QZTJIDSGSA-N |
|---|---|
| Compound Name | Filorexant |
| Canonical SMILES | Cc1ccc(-c2ncccn2)c(C(=O)N2C[C@H](COc3ccc(F)cn3)CC[C@H]2C)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 9.06 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12158 |
|---|---|
| Drug Name | Filorexant |
| CAS Number | 1088991-73-4 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Filorexant has been used in trials studying the prevention and treatment of Migraine, Headache, Polysomnography, Diabetic Neuropathy, Painful, and Major Depressive Disorder, Recurrent. |
Cross-references: BindingDB: 104692 CHEMBL2107822 ChemSpider: 28528372 PDB: NT5 PubChem:25128145 PubChem:347828451 Wikipedia: Filorexant ZINC: ZINC000043201232