Molecule Details
| InChIKey | NPAGDVCDWIYMMC-IZPLOLCNSA-N |
|---|---|
| Compound Name | Nandrolone |
| Canonical SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@H]43)[C@@H]1CC[C@@H]2O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.22 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13169 |
|---|---|
| Drug Name | Nandrolone |
| CAS Number | 434-22-0 |
| Groups | investigational |
| ATC Codes | S01XA11 A14AB01 |
| Description | Nandrolone, also known as 19-nortestosterone or 19-norandrostenolone, is a synthetic anabolic-androgenic steroid (AAS) derived from testosterone. |
Categories: Alimentary Tract and Metabolism Anabolic Agents Anabolic Agents for Systemic Use Anabolic Steroids Androgens Estranes Estren Derivatives Estrenes Fused-Ring Compounds Gonadal Hormones Gonadal Steroid Hormones Hormones Hormones, Hormone Substitutes, and Hormone Antagonists Nandrolone and esters Ophthalmologicals Sensory Organs Steroids Testosterone Congeners Thyroxine-binding globulin inhibitors
Cross-references: BindingDB: 50080092 ChEBI: 7466 CHEMBL757 ChemSpider: 9520 C07254 PDB: 6VW PharmGKB: PA164746281 PubChem:9904 PubChem:347829275 RxCUI: 7244 Wikipedia: Nandrolone ZINC: ZINC000003814379
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P10275 | AR | Androgen receptor | agonist | targets |