Molecule Details
| InChIKey | NFHRQQKPEBFUJK-HSZRJFAPSA-N |
|---|---|
| Compound Name | Devazepide |
| Canonical SMILES | CN1C(=O)[C@@H](NC(=O)c2cc3ccccc3[nH]2)N=C(c2ccccc2)c2ccccc21 |
| Clinical Status | Clinical Multi-Target |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.15 |
| Source | BindingDB;ChEMBL;TTD_MultiTarget |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB20841 |
|---|---|
| Drug Name | Devazepide |
| CAS Number | 103420-77-5 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Devazepide is a small molecule drug. Devazepide has a monoisotopic molecular weight of 408.16 Da. |
Categories: Benzazepines Benzodiazepines and benzodiazepine derivatives Benzodiazepinones Central Nervous System Depressants Heterocyclic Compounds, Fused-Ring Hormone Antagonists Hormones, Hormone Substitutes, and Hormone Antagonists
Cross-references: BindingDB: 50005463 ChEBI: 4460 CHEMBL9506 C11710 PDB: 1OZ ZINC: ZINC000001847292
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P32238 | CCKAR | Cholecystokinin receptor type A | antagonist | targets |