Molecule Details
| InChIKey | NEBUOXBYNAHKFV-NRFANRHFSA-N |
|---|---|
| Compound Name | Funapide |
| Canonical SMILES | O=C1N(Cc2ccc(C(F)(F)F)o2)c2ccccc2[C@]12COc1cc3c(cc12)OCO3 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.17 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11769 |
|---|---|
| Drug Name | Funapide |
| CAS Number | 1259933-16-8 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Funapide has been used in trials studying the treatment of Pharmacokinetics, Postherpetic Neuralgia, and Osteoarthritis of the Knee. |
Categories: Heterocyclic Compounds, Fused-Ring
Cross-references: BindingDB: 206760 CHEMBL3707218 ChemSpider: 34500834 PubChem:49836093 PubChem:347828122 Wikipedia: Funapide ZINC: ZINC000113473392
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q15858 | SCN9A | Homo sapiens | Human | PF00520 PF24609 PF06512 PF11933 | 8.5 | IC50 | ChEMBL;BindingDB |
| Q01118 | SCN7A | Homo sapiens | Human | PF00520 PF24609 PF06512 | 7.3 | IC50 | ChEMBL;BindingDB |
| Q14524 | SCN5A | Homo sapiens | Human | PF00520 PF24609 PF06512 PF11933 | 7.1 | IC50 | ChEMBL;BindingDB |
| Q9UQD0 | SCN8A | Homo sapiens | Human | PF00520 PF24609 PF06512 PF11933 | 6.8 | IC50 | ChEMBL;BindingDB |
| Q99250 | SCN2A | Homo sapiens | Human | PF00520 PF24609 PF06512 PF11933 | 6.2 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q15858 | SCN9A | Sodium channel protein type 9 subunit alpha | inhibitor | targets |