Molecule Details
| InChIKey | NDDAHWYSQHTHNT-UHFFFAOYSA-N |
|---|---|
| Compound Name | Indapamide |
| Canonical SMILES | CC1Cc2ccccc2N1NC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| Clinical Status | Clinical Multi-Target |
| Targets (Human+Pathogen) | 13 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.07 |
| Source | ChEMBL;BindingDB;TTD_MultiTarget |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00808 |
|---|---|
| Drug Name | Indapamide |
| CAS Number | 26807-65-8 |
| Groups | approved investigational |
| ATC Codes | C03BA11 C09BX01 G01AE10 C10BX13 C09BX06 |
| Description | The most significant modifiable risk factor for cardiovascular disease and the most prominent contributor to all-cause mortality is hypertension.[A204155] Characterized by an office blood pressure of ≥140/90, hypertension is pervasive and impacts an estimated 25% of adults globally.[A204155] Treatme... |
Categories: Amides Antihypertensive Agents Antihypertensive Agents Indicated for Hypertension Cardiovascular Agents Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Substrates Diuretics Drugs causing inadvertant photosensitivity Drugs that are Mainly Renally Excreted Genito Urinary System and Sex Hormones Heterocyclic Compounds, Fused-Ring Hyperglycemia-Associated Agents Hypotensive Agents Increased Diuresis Indoles Lipid Modifying Agents Low-Ceiling Diuretics, Excl. Thiazides Membrane Transport Modulators Natriuretic Agents Non Potassium Sparing Diuretics Photosensitizing Agents Potential QTc-Prolonging Agents QTc Prolonging Agents Sodium Chloride Symporter Inhibitors Sulfonamides Sulfones Sulfur Compounds Thiazide-like Diuretic
Cross-references: BindingDB: 50647947 ChEBI: 5893 CHEMBL406 ChemSpider: 3574 Drugs Product Database (DPD): 1960 D00345 PharmGKB: PA449975 PubChem:3702 PubChem:46508626 RxCUI: 5764 Therapeutic Targets Database: DAP000498 Wikipedia: Indapamide
Target Activities (13)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q9ULX7 | CA14 | Homo sapiens | Human | PF00194 | 8.3 | Kd | ChEMBL |
| O43570 | CA12 | Homo sapiens | Human | PF00194 | 8.0 | Kd | ChEMBL |
| P18505 | GABRB1 | Homo sapiens | Human | PF02931 PF02932 | 7.4 | pIC50 | TTD_MultiTarget |
| Q16790 | CA9 | Homo sapiens | Human | PF00194 | 7.4 | Kd | ChEMBL |
| Q9Y2D0 | CA5B | Homo sapiens | Human | PF00194 | 7.2 | Kd | ChEMBL |
| P22748 | CA4 | Homo sapiens | Human | PF00194 | 7.1 | Kd | ChEMBL |
| Q8N1Q1 | CA13 | Homo sapiens | Human | PF00194 | 7.0 | Kd | ChEMBL;BindingDB |
| P07451 | CA3 | Homo sapiens | Human | PF00194 | 7.0 | Kd | ChEMBL |
| P23280 | CA6 | Homo sapiens | Human | PF00194 | 6.6 | Kd | ChEMBL |
| P43166 | CA7 | Homo sapiens | Human | PF00194 | 6.6 | Kd | ChEMBL;BindingDB |
| P00915 | CA1 | Homo sapiens | Human | PF00194 | 6.6 | Kd | ChEMBL |
| P00918 | CA2 | Homo sapiens | Human | PF00194 | 6.5 | Kd | ChEMBL;BindingDB |
| P35218 | CA5A | Homo sapiens | Human | PF00194 | 6.2 | Kd | ChEMBL |
DrugBank Target Actions (6)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02763 | P02763 | alpha1-acid glycoprotein | binder | carriers |
| P02768 | ALB | Albumin | binder | carriers |
| P07099 | EPHX1 | Epoxide hydrolase 1 | substrate | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P51787 | KCNQ1 | Potassium voltage-gated channel subfamily KQT member 1 | blocker | targets |
| P55017 | P55017 | Solute carrier family 12 member 3 | inhibitor | targets |