Molecule Details
| InChIKey | NCLGDOBQAWBXRA-PGRDOPGGSA-N |
|---|---|
| Canonical SMILES | Cc1ccn(-c2cc(Cl)ccc2[C@@H](Oc2cc(-c3ccc(C[C@H](N)C(=O)O)cc3)nc(N)n2)C(F)(F)F)n1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.83 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB14218 |
|---|---|
| Drug Name | Telotristat |
| CAS Number | 1033805-28-5 |
| Groups | investigational |
| ATC Codes | A16AX15 |
| Description | A tryptophan hydroxylase inhibitor. [Telotristat ethyl] (brand name Xermelo) is a prodrug of telotristat. |
Categories: Alimentary Tract and Metabolism Amino Acids Amino Acids, Aromatic Amino Acids, Cyclic Amino Acids, Peptides, and Proteins Antidiarrheals Tryptophan Hydroxylase Inhibitor Tryptophan Hydroxylase Inhibitors Various Alimentary Tract and Metabolism Products
Cross-references: BindingDB: 50145648 ChEBI: 177736 CHEMBL2103855 ChemSpider: 28189675 PDB: A1IT9 RxCUI: 1872382 Wikipedia: Telotristat_ethyl ZINC: ZINC000084758235