Molecule Details
| InChIKey | NBQKINXMPLXUET-UHFFFAOYSA-N |
|---|---|
| Compound Name | Pranlukast |
| Canonical SMILES | O=C(Nc1cccc2c(=O)cc(-c3nnn[nH]3)oc12)c1ccc(OCCCCc2ccccc2)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 9.05 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01411 |
|---|---|
| Drug Name | Pranlukast |
| CAS Number | 103177-37-3 |
| Groups | investigational |
| ATC Codes | R03DC02 |
| Description | Pranlukast is a cysteinyl leukotriene receptor-1 antagonist. It antagonizes or reduces bronchospasm caused, principally in asthmatics, by an allergic reaction to accidentally or inadvertently encountered allergens. |
Categories: Agents to Treat Airway Disease Anti-Asthmatic Agents Benzopyrans Cytochrome P-450 CYP2C9 Inhibitors Cytochrome P-450 CYP2C9 Inhibitors (strength unknown) Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A4 Substrates (strength unknown) Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Drugs for Obstructive Airway Diseases Heterocyclic Compounds, Fused-Ring Hormone Antagonists Hormones, Hormone Substitutes, and Hormone Antagonists Leukotriene Antagonists Pyrans Respiratory System Agents
Cross-references: BindingDB: 50023198 ChEBI: 94810 CHEMBL21333 ChemSpider: 4718 PDB: KNT PharmGKB: PA134698661 PubChem:4887 PubChem:46508129 Therapeutic Targets Database: DAP000977 Wikipedia: Pranlukast ZINC: ZINC000001542146
Target Activities (2)
DrugBank Target Actions (10)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P11712 | CYP2C9 | Cytochrome P450 2C9 | inhibitor | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P05113 | P05113 | Interleukin-5 | antagonist | targets |
| Q9Y271 | CYSLTR1 | Cysteinyl leukotriene receptor 1 | antagonist | targets |
| Q00653 | NFKB2 | Nuclear factor NF-kappa-B | inhibitor | targets |
| P01375 | TNF | Tumor necrosis factor | other/unknown | targets |
| P12724 | P12724 | Eosinophil cationic protein | other/unknown | targets |
| P19838 | NFKB1 | Nuclear factor NF-kappa-B p105 subunit | other/unknown | targets |
| Q02817 | Q02817 | Mucin-2 | other/unknown | targets |
| Q92887 | ABCC2 | ATP-binding cassette sub-family C member 2 | inhibitor | transporters |