Molecule Details
| InChIKey | MYSWGUAQZAJSOK-UHFFFAOYSA-N |
|---|---|
| Compound Name | Ciprofloxacin |
| Canonical SMILES | O=C(O)c1cn(C2CC2)c2cc(N3CCNCC3)c(F)cc2c1=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.35 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00537 |
|---|---|
| Drug Name | Ciprofloxacin |
| CAS Number | 85721-33-1 |
| Groups | approved investigational |
| ATC Codes | J01RA11 S03AA07 J01MA02 S02AA15 J01RA10 J01RA12 S01AE03 |
| Description | Ciprofloxacin is a second generation fluoroquinolone that has spawned many derivative antibiotics.[A178870] It is formulated for oral, intravenous, intratympanic, ophthalmic, and otic administration for a number of bacterial infections.[L6469,L6472,L6475,L6478,L6481,L6484,L6487,L6490,L6493] The firs... |
Categories: 4-Quinolones Agents Causing Muscle Toxicity Anti-Bacterial Agents Anti-Infective Agents Antibacterials for Systemic Use Antiinfectives for Systemic Use Chemically-Induced Disorders Cytochrome P-450 CYP1A2 Inhibitors Cytochrome P-450 CYP1A2 Inhibitors (strong) Cytochrome P-450 CYP3A Inhibitors Cytochrome P-450 CYP3A4 Inhibitors Cytochrome P-450 CYP3A4 Inhibitors (moderate) Cytochrome P-450 CYP3A5 Inhibitors Cytochrome P-450 CYP3A5 Inhibitors (moderate) Cytochrome P-450 CYP3A7 Inhibitors Cytochrome P-450 CYP3A7 Inhibitors (moderate) Cytochrome P-450 Enzyme Inhibitors Drugs causing inadvertant photosensitivity Drugs that are Mainly Renally Excreted Enzyme Inhibitors Fluoroquinolone Antibacterial Fluoroquinolones Heterocyclic Compounds, Fused-Ring MATE 1 Inhibitors MATE 1 Substrates MATE 2 Inhibitors MATE inhibitors MATE substrates Moderate Risk QTc-Prolonging Agents Ophthalmological and Otological Preparations Ophthalmologicals Otologicals P-glycoprotein substrates Photosensitizing Agents QTc Prolonging Agents Quinolines Quinolone Antimicrobial Quinolones Sensory Organs Topoisomerase II Inhibitors Topoisomerase Inhibitors
Cross-references: BindingDB: 21690 ChEBI: 192484 CHEMBL8 ChemSpider: 2662 Drugs Product Database (DPD): 93 C05349 D00186 PDB: CPF PharmGKB: PA449009 PubChem:2764 PubChem:46504733 RxCUI: 2551 Therapeutic Targets Database: DAP001360 Wikipedia: Ciprofloxacin ZINC: ZINC000000020220
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q02880 | TOP2B | Homo sapiens | Human | PF00204 PF00521 PF08070 PF02518 PF01751 PF16898 | 6.1 | IC50 | BindingDB |
| P33012 | sbmC | Escherichia coli (strain K12) | Pathogen | PF06445 | 6.6 | IC50 | BindingDB |
| Q47245 | gyrA | Escherichia coli | Pathogen | PF03989 PF00521 | 6.5 | IC50 | BindingDB |
| P0AES6 | gyrB | Escherichia coli (strain K12) | Pathogen | PF00204 PF00986 PF21249 PF18053 PF02518 PF01751 | 6.5 | IC50 | ChEMBL |
| P0C1S7 | parE | Staphylococcus aureus | Pathogen | PF00204 PF00986 PF02518 PF01751 | 6.3 | IC50 | ChEMBL |
| P0C1U9 | parC | Staphylococcus aureus | Pathogen | PF03989 PF00521 | 6.0 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (22)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02768 | ALB | Albumin | binder | carriers |
| P05177 | CYP1A2 | Cytochrome P450 1A2 | inhibitor | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | inhibitor | enzymes |
| P20815 | CYP3A5 | Cytochrome P450 3A5 | inhibitor | enzymes |
| P24462 | CYP3A7 | Cytochrome P450 3A7 | inhibitor | enzymes |
| B4YQT9 | B4YQT9 | Gyrase A | inhibitor | targets |
| P05653 | P05653 | DNA gyrase subunit A | inhibitor | targets |
| P0AES4 | gyrA | DNA gyrase subunit A | inhibitor | targets |
| P0C1U9 | parC | DNA topoisomerase 4 subunit A | inhibitor | targets |
| P11388 | TOP2A | DNA topoisomerase 2-alpha | inhibitor | targets |
| P12461 | P12461 | Thymidylate synthase | inhibitor | targets |
| P43700 | P43700 | DNA gyrase subunit A | inhibitor | targets |
| P43702 | P43702 | DNA topoisomerase 4 subunit A | inhibitor | targets |
| Q12809 | KCNH2 | Voltage-gated inwardly rectifying potassium channel KCNH2 | inhibitor | targets |
| Q59192 | Q59192 | DNA topoisomerase 4 subunit B | inhibitor | targets |
| P0A0K8 | gyrB | DNA gyrase subunit B | modulator | targets |
| P20831 | gyrA | DNA gyrase subunit A | modulator | targets |
| C3T8E2 | C3T8E2 | Multidrug resistance protein MdtK | substrate | targets |
| Q86VL8 | SLC47A2 | Multidrug and toxin extrusion protein 2 | inhibitor | transporters |
| Q96FL8 | SLC47A1 | Multidrug and toxin extrusion protein 1 | inhibitor | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |
| Q96FL8 | SLC47A1 | Multidrug and toxin extrusion protein 1 | substrate | transporters |