Molecule Details
| InChIKey | MXXWOMGUGJBKIW-YPCIICBESA-N |
|---|---|
| Compound Name | Piperine |
| Canonical SMILES | O=C(/C=C/C=C/c1ccc2c(c1)OCO2)N1CCCCC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.21 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12582 |
|---|---|
| Drug Name | Piperine |
| CAS Number | 94-62-2 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Bioperine has been used in trials studying the treatment of Multiple Myeloma and Deglutition Disorders. |
Categories: Alkenes Alkynes Amides Cytochrome P-450 CYP3A Inhibitors Cytochrome P-450 CYP3A4 Inhibitors Cytochrome P-450 CYP3A4 Inhibitors (strength unknown) Cytochrome P-450 Enzyme Inhibitors Dioxoles Enzyme Inhibitors Heterocyclic Compounds, Fused-Ring Hydrocarbons, Acyclic Monoamine Oxidase A Inhibitors for interaction with Monoamine Oxidase A substrates P-glycoprotein inhibitors Piper nigrum
Cross-references: BindingDB: 50148573 ChEBI: 28821 CHEMBL43185 ChemSpider: 553590 C03882 PDB: AYR PubChem:638024 PubChem:347828804 RxCUI: 1311146 Wikipedia: Piperine ZINC: ZINC000001529772
Target Activities (2)
DrugBank Target Actions (5)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08684 | CYP3A4 | Cytochrome P450 3A4 | inhibitor | enzymes |
| O75469 | NR1I2 | Nuclear receptor subfamily 1 group I member 2 | binder | targets |
| P21397 | MAOA | Amine oxidase [flavin-containing] A | inhibitor | targets |
| P27338 | MAOB | Amine oxidase [flavin-containing] B | inhibitor | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | inhibitor | transporters |