Molecule Details
| InChIKey | MWYHLEQJTQJHSS-UHFFFAOYSA-N |
|---|---|
| Compound Name | Tomelukast |
| Canonical SMILES | CCCc1c(OCCCCc2nnn[nH]2)ccc(C(C)=O)c1O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.13 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB20018 |
|---|---|
| Drug Name | Tomelukast |
| CAS Number | 88107-10-2 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Tomelukast is a small molecule drug. The usage of the INN stem '-lukast' in the name indicates that Tomelukast is a leukotriene receptor antagonist. Tomelukast has a monoisotopic molecular weight of 318.17 Da. |
Categories: Hormone Antagonists Hormones, Hormone Substitutes, and Hormone Antagonists Ketones Leukotriene Antagonists
Cross-references: BindingDB: 50006816 ChEBI: 75310 CHEMBL162358 ZINC: ZINC000003873163
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q9Y271 | CYSLTR1 | Cysteinyl leukotriene receptor 1 | modulator | targets |