Molecule Details
| InChIKey | MWUFVYLAWAXDHQ-HMNLTAHHSA-N |
|---|---|
| Canonical SMILES | CCNc1cc(O)c2c(c1)/C=C/C[C@H](O)[C@H](O)C(=O)/C=C\[C@@H](C)[C@H](C)OC2=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.8 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11687 |
|---|---|
| Drug Name | E-6201 |
| CAS Number | 603987-35-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | E6201 has been investigated for the treatment of Chronic Plaque Psoriasis. |
Cross-references: CHEMBL1097999 ChemSpider: 8348332 PDB: E26 PubChem:10172827 PubChem:347828053 ZINC: ZINC000034374629