Molecule Details
| InChIKey | MVWVFYHBGMAFLY-UHFFFAOYSA-N |
|---|---|
| Compound Name | Ziprasidone |
| Canonical SMILES | O=C1Cc2cc(CCN3CCN(c4nsc5ccccc45)CC3)c(Cl)cc2N1 |
| Clinical Status | Clinical Multi-Target |
| Targets (Human+Pathogen) | 31 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.43 |
| Source | BindingDB;ChEMBL;TTD_MultiTarget |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00246 |
|---|---|
| Drug Name | Ziprasidone |
| CAS Number | 146939-27-7 |
| Groups | approved investigational |
| ATC Codes | N05AE04 |
| Description | Disorders such as schizophrenia and bipolar disorder can significantly impair mood, cognition, and behavior.[A190525] These mental illnesses can often be accompanied by comorbidities such as depression and substance abuse, and can significantly impact the quality of life of patients and caregivers.[... |
Categories: Adrenergic Antagonists Adrenergic alpha-1 Receptor Antagonists Adrenergic alpha-Antagonists Agents that produce hypertension Anticholinergic Agents Antidepressive Agents Antipsychotic Agents Antipsychotic Agents (Second Generation [Atypical]) Central Nervous System Agents Central Nervous System Depressants Cytochrome P-450 CYP2D6 Inhibitors Cytochrome P-450 CYP2D6 Inhibitors (weak) Cytochrome P-450 CYP3A Inhibitors Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Inhibitors Cytochrome P-450 CYP3A4 Inhibitors (moderate) Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A4 Substrates (strength unknown) Cytochrome P-450 CYP3A5 Substrates Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Dopamine Agents Dopamine Antagonists Dopamine D2 Receptor Antagonists Highest Risk QTc-Prolonging Agents Histamine Antagonists Histamine H1 Antagonists Hyperglycemia-Associated Agents Indole Derivatives Muscarinic Antagonists Nervous System Neurotoxic agents Neurotransmitter Agents Psycholeptics Psychotropic Drugs QTc Prolonging Agents Serotonergic Drugs Shown to Increase Risk of Serotonin Syndrome Serotonin 5-HT1 Receptor Agonists Serotonin 5-HT1 Receptor Antagonists Serotonin 5-HT1D Receptor Antagonists Serotonin 5-HT2 Receptor Antagonists Serotonin 5-HT2A Receptor Antagonists Serotonin 5-HT2C Receptor Antagonists Serotonin Agents Serotonin Receptor Agonists Serotonin Receptor Antagonists Sulfur Compounds Tranquilizing Agents
Cross-references: BindingDB: 50048803 ChEBI: 10119 CHEMBL708 ChemSpider: 54841 Drugs Product Database (DPD): 11753 Guide to Pharmacology: 59 IUPHAR: 59 C07568 D08687 PDB: XEF PharmGKB: PA451974 PubChem:60854 PubChem:46507627 RxCUI: 115698 Therapeutic Targets Database: DAP000079 Wikipedia: Ziprasidone ZINC: ZINC000000538550
Target Activities (31)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 9.5 | Ki | ChEMBL;BindingDB |
| P28222 | HTR1B | Homo sapiens | Human | PF00001 | 9.0 | Ki | BindingDB |
| P41595 | HTR2B | Homo sapiens | Human | PF00001 | 8.8 | Ki | ChEMBL;BindingDB |
| P35348 | ADRA1A | Homo sapiens | Human | PF00001 | 8.7 | pIC50 | TTD_MultiTarget |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 8.6 | Ki | ChEMBL;BindingDB |
| P08908 | HTR1A | Homo sapiens | Human | PF00001 | 8.6 | Ki | ChEMBL;BindingDB |
| P28221 | HTR1D | Homo sapiens | Human | PF00001 | 8.4 | Ki | BindingDB |
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 8.4 | Ki | ChEMBL;BindingDB |
| P34969 | HTR7 | Homo sapiens | Human | PF00001 | 8.3 | Ki | ChEMBL;BindingDB |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 8.1 | Ki | ChEMBL;BindingDB |
| P25100 | ADRA1D | Homo sapiens | Human | PF00001 | 8.0 | Ki | ChEMBL |
| P35368 | ADRA1B | Homo sapiens | Human | PF00001 | 8.0 | Ki | ChEMBL |
| P07305 | H1-0 | Homo sapiens | Human | PF00538 | 7.8 | Ki | BindingDB |
| P21917 | DRD4 | Homo sapiens | Human | PF00001 | 7.4 | Ki | ChEMBL;BindingDB |
| P35367 | HRH1 | Homo sapiens | Human | PF00001 | 7.3 | Ki | ChEMBL;BindingDB |
| P50406 | HTR6 | Homo sapiens | Human | PF00001 | 7.2 | Ki | ChEMBL;BindingDB |
| P31645 | SLC6A4 | Homo sapiens | Human | PF03491 PF00209 | 7.1 | Ki | ChEMBL;BindingDB |
| Q12809 | KCNH2 | Homo sapiens | Human | PF00027 PF00520 PF13426 | 6.9 | IC50 | ChEMBL;BindingDB |
| P21728 | DRD1 | Homo sapiens | Human | PF00001 | 6.9 | Ki | ChEMBL;BindingDB |
| P18089 | ADRA2B | Homo sapiens | Human | PF00001 | 6.9 | Ki | ChEMBL;BindingDB |
| P18825 | ADRA2C | Homo sapiens | Human | PF00001 | 6.8 | Ki | ChEMBL;BindingDB |
| P08913 | ADRA2A | Homo sapiens | Human | PF00001 | 6.6 | Ki | ChEMBL;BindingDB |
| P11229 | CHRM1 | Homo sapiens | Human | PF00001 | 6.5 | Ki | BindingDB |
| P28566 | HTR1E | Homo sapiens | Human | PF00001 | 6.4 | Ki | BindingDB |
| A5X5Y0 | HTR3E | Homo sapiens | Human | PF02931 PF02932 | 6.4 | Ki | ChEMBL |
| O95264 | HTR3B | Homo sapiens | Human | PF02931 PF02932 | 6.4 | Ki | ChEMBL |
| P46098 | HTR3A | Homo sapiens | Human | PF02931 PF02932 | 6.4 | Ki | ChEMBL |
| Q70Z44 | HTR3D | Homo sapiens | Human | PF02931 PF02932 | 6.4 | Ki | ChEMBL |
| Q8WXA8 | HTR3C | Homo sapiens | Human | PF02931 PF02932 | 6.4 | Ki | ChEMBL |
| P20366 | TAC1 | Homo sapiens | Human | PF02202 | 6.0 | Ki | BindingDB |
| P21731 | TBXA2R | Homo sapiens | Human | PF00001 | 6.0 | Ki | BindingDB |
DrugBank Target Actions (32)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02763 | P02763 | Alpha-1-acid glycoprotein 1 | binder | carriers |
| P02768 | ALB | Albumin | binder | carriers |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| Q06278 | AOX1 | Aldehyde oxidase | substrate | enzymes |
| P08908 | HTR1A | 5-hydroxytryptamine receptor 1A | agonist | targets |
| P08172 | CHRM2 | Muscarinic acetylcholine receptor M2 | antagonist | targets |
| P08173 | CHRM4 | Muscarinic acetylcholine receptor M4 | antagonist | targets |
| P08912 | CHRM5 | Muscarinic acetylcholine receptor M5 | antagonist | targets |
| P08913 | ADRA2A | Alpha-2A adrenergic receptor | antagonist | targets |
| P11229 | CHRM1 | Muscarinic acetylcholine receptor M1 | antagonist | targets |
| P14416 | DRD2 | D(2) dopamine receptor | antagonist | targets |
| P18089 | ADRA2B | Alpha-2B adrenergic receptor | antagonist | targets |
| P18825 | ADRA2C | Alpha-2C adrenergic receptor | antagonist | targets |
| P20309 | CHRM3 | Muscarinic acetylcholine receptor M3 | antagonist | targets |
| P21728 | DRD1 | D(1A) dopamine receptor | antagonist | targets |
| P21917 | DRD4 | D(4) dopamine receptor | antagonist | targets |
| P21918 | DRD5 | D(1B) dopamine receptor | antagonist | targets |
| P28221 | HTR1D | 5-hydroxytryptamine receptor 1D | antagonist | targets |
| P28222 | HTR1B | 5-hydroxytryptamine receptor 1B | antagonist | targets |
| P28223 | HTR2A | 5-hydroxytryptamine receptor 2A | antagonist | targets |
| P28335 | HTR2C | 5-hydroxytryptamine receptor 2C | antagonist | targets |
| P28566 | HTR1E | 5-hydroxytryptamine receptor 1E | antagonist | targets |
| P34969 | HTR7 | 5-hydroxytryptamine receptor 7 | antagonist | targets |
| P35348 | ADRA1A | Alpha-1A adrenergic receptor | antagonist | targets |
| P35367 | HRH1 | Histamine H1 receptor | antagonist | targets |
| P35368 | ADRA1B | Alpha-1B adrenergic receptor | antagonist | targets |
| P35462 | DRD3 | D(3) dopamine receptor | antagonist | targets |
| P46098 | HTR3A | 5-hydroxytryptamine 3 receptor | antagonist | targets |
| P47898 | HTR5A | 5-hydroxytryptamine receptor 5A | antagonist | targets |
| P50406 | HTR6 | 5-hydroxytryptamine receptor 6 | antagonist | targets |
| P36544 | CHRNA7 | Neuronal acetylcholine receptor subunit alpha-7 | binder | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | binder | transporters |