Molecule Details
| InChIKey | MSTNYGQPCMXVAQ-KIYNQFGBSA-N |
|---|---|
| Compound Name | Tetrahydrofolic acid |
| Canonical SMILES | Nc1nc2c(c(=O)[nH]1)NC(CNc1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1)CN2 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.81 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00116 |
|---|---|
| Drug Name | Tetrahydrofolic acid |
| CAS Number | 135-16-0 |
| Groups | investigational nutraceutical |
| ATC Codes | nan |
| Description | Tetrahydrofolic acid is a folic acid derivative that is produced from dihydrofolic acid after conversion by dihydrofolate reductase. It is converted into 5,10-methylenetetrahydrofolate by serine hydroxymethyltransferase. It is a soluble coenzyme in many reactions, especially in the metabolism of ami... |
Categories: Coenzymes Dietary Supplements Enzymes and Coenzymes Folic Acid and Derivatives Heterocyclic Compounds, Fused-Ring Pteridines Pterins Supplements Vitamin B Complex Vitamins
Cross-references: BindingDB: 50635017 ChEBI: 20506 CHEMBL2021342 ChemSpider: 82572 C00101 PharmGKB: PA164745110 PubChem:91443 PubChem:46504756 Therapeutic Targets Database: DAP001308 Wikipedia: Tetrahydrofolic_acid
Target Activities (3)
DrugBank Target Actions (13)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| O75891 | O75891 | Cytosolic 10-formyltetrahydrofolate dehydrogenase | cofactor | targets |
| O95954 | O95954 | Formimidoyltransferase-cyclodeaminase | cofactor | targets |
| P11586 | MTHFD1 | C-1-tetrahydrofolate synthase, cytoplasmic | cofactor | targets |
| P13995 | MTHFD2 | Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial | cofactor | targets |
| P31939 | ATIC | Bifunctional purine biosynthesis protein ATIC | cofactor | targets |
| P34896 | SHMT1 | Serine hydroxymethyltransferase, cytosolic | cofactor | targets |
| P34897 | SHMT2 | Serine hydroxymethyltransferase, mitochondrial | cofactor | targets |
| P42898 | P42898 | Methylenetetrahydrofolate reductase (NADPH) | cofactor | targets |
| P48728 | P48728 | Aminomethyltransferase, mitochondrial | cofactor | targets |
| Q53ET4 | Q53ET4 | Serine hydroxymethyltransferase | cofactor | targets |
| Q96DP5 | Q96DP5 | Methionyl-tRNA formyltransferase, mitochondrial | cofactor | targets |
| Q99707 | MTR | Methionine synthase | cofactor | targets |
| Q92887 | ABCC2 | ATP-binding cassette sub-family C member 2 | inhibitor | transporters |