Molecule Details
| InChIKey | MROBUJILSMBILX-FOIQADDNSA-N |
|---|---|
| Canonical SMILES | Cc1cnc(-c2cc(OC[C@H]3CN(C)CCO3)cc(C(=O)N[C@H](C)c3cnc(C(F)(F)F)nc3)c2)s1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.13 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21467 |
|---|---|
| Drug Name | Filapixant |
| CAS Number | 1948232-63-0 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Filapixant is a small molecule drug. The usage of the INN stem '-pixant' in the name indicates that Filapixant is a purinoreceptor (P2X) antagonist. Filapixant has a monoisotopic molecular weight of 521.17 Da. |
Cross-references: BindingDB: 320181 CHEMBL5802745