Molecule Details
| InChIKey | MQOBSOSZFYZQOK-UHFFFAOYSA-N |
|---|---|
| Compound Name | Fenofibric Acid |
| Canonical SMILES | CC(C)(Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1)C(=O)O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.28 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13873 |
|---|---|
| Drug Name | Fenofibric acid |
| CAS Number | 42017-89-0 |
| Groups | approved investigational |
| ATC Codes | C10AB11 |
| Description | Fenofibric acid is a lipid-lowering agent that is used in severe hypertriglyceridemia, primary hyperlipidemia, and mixed dyslipidemia. It works to decrease elevated low-density lipoprotein cholesterol, total cholesterol, triglycerides, apolipoprotein B, while increasing high-density lipoprotein chol... |
Categories: Acids, Acyclic Agents Causing Muscle Toxicity Anticholesteremic Agents Benzene Derivatives Benzophenones Butyrates Drugs that are Mainly Renally Excreted Ethers Fibric Acids Hypolipidemic Agents Hypolipidemic Agents Indicated for Hyperlipidemia Isobutyrates Ketones Lipid Modifying Agents Lipid Modifying Agents, Plain Lipid Regulating Agents Non-statin Hypolipidemic Agents Indicated for Hyperlipidemia Peroxisome Proliferator Receptor alpha Agonist Phenols Phenyl Ethers
Cross-references: BindingDB: 28700 ChEBI: 83469 CHEMBL981 ChemSpider: 58457 PDB: F5A PubChem:64929 PubChem:347829325 RxCUI: 24852 Wikipedia: Fenofibrate ZINC: ZINC000000001984
Target Activities (2)
DrugBank Target Actions (6)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q07869 | PPARA | Peroxisome proliferator-activated receptor alpha | agonist | targets |
| P37231 | PPARG | Peroxisome proliferator-activated receptor gamma | binder | targets |
| P07148 | FABP1 | Fatty acid-binding protein, liver | inhibitor | targets |
| O75469 | NR1I2 | Nuclear receptor subfamily 1 group I member 2 | partial agonist | targets |
| Q03181 | PPARD | Peroxisome proliferator-activated receptor delta | unknown | targets |
| Q9NPA2 | MMP25 | Matrix metalloproteinase-25 | unknown | targets |