Molecule Details
| InChIKey | MPUQHZXIXSTTDU-QXGSTGNESA-N |
|---|---|
| Compound Name | Pevonedistat |
| Canonical SMILES | NS(=O)(=O)OC[C@@H]1C[C@@H](n2ccc3c(N[C@H]4CCc5ccccc54)ncnc32)C[C@@H]1O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.38 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11759 |
|---|---|
| Drug Name | Pevonedistat |
| CAS Number | 905579-51-3 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Pevonedistat has been used in trials studying the treatment of Lymphoma, Solid Tumors, Multiple Myeloma, Hodgkin Lymphoma, and Metastatic Melanoma, among others. |
Categories: Cycloparaffins Enzyme Inhibitors
Cross-references: BindingDB: 50285607 ChEBI: 95028 CHEMBL1231160 ChemSpider: 17625129 PDB: B39 PubChem:16720766 PubChem:347828113 Wikipedia: Pevonedistat ZINC: ZINC000058660702