Molecule Details
| InChIKey | MPDGHEJMBKOTSU-YKLVYJNSSA-N |
|---|---|
| Compound Name | Glycyrrhetinic Acid |
| Canonical SMILES | CC1(C)[C@@H](O)CC[C@]2(C)[C@H]3C(=O)C=C4[C@@H]5C[C@@](C)(C(=O)O)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.22 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13089 |
|---|---|
| Drug Name | Enoxolone |
| CAS Number | 471-53-4 |
| Groups | investigational |
| ATC Codes | D03AX10 |
| Description | Enoxolone (glycyrrhetic acid) has been investigated for the basic science of Apparent Mineralocorticoid Excess (AME). |
Categories: Anti-Inflammatory Agents Cicatrizants Dermatologicals Pentacyclic Triterpenes Preparations for Treatment of Wounds and Ulcers Terpenes Triterpenes
Cross-references: BindingDB: 50233538 ChEBI: 30853 CHEMBL230006 ChemSpider: 9710 C02283 PDB: CBW PubChem:10114 PubChem:347829213 RxCUI: 1311506 Wikipedia: Enoxolone ZINC: ZINC000019203131
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P80365 | HSD11B2 | Homo sapiens | Human | PF00106 | 8.9 | IC50 | ChEMBL;BindingDB |
| P28845 | HSD11B1 | Homo sapiens | Human | PF00106 | 7.9 | IC50 | ChEMBL;BindingDB |
| P24723 | PRKCH | Homo sapiens | Human | PF00130 PF00168 PF00069 PF00433 | 6.6 | Kd | ChEMBL;BindingDB |
| Q9Y6L6 | SLCO1B1 | Homo sapiens | Human | PF07648 PF03137 | 6.4 | IC50 | ChEMBL;BindingDB |
| Q9NPD5 | SLCO1B3 | Homo sapiens | Human | PF07648 PF03137 | 6.3 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P18031 | PTPN1 | Tyrosine-protein phosphatase non-receptor type 1 | inhibitor | targets |