Molecule Details
| InChIKey | MMJJNHOIVCGAAP-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | CCOC(=O)N1CCC(CN(Cc2ccc(Cl)cc2)Cc2ccc([N+](=O)[O-])s2)C1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.13 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB14013 |
|---|---|
| Drug Name | SR-9009 |
| CAS Number | 1379686-30-2 |
| Groups | experimental |
| ATC Codes | nan |
| Description | SR-9009 is a REV-ERB agonist. SR-9011 has been demonstrated that it is specifically lethal to cancer cells and oncogene-induced senescent cells, including melanocytic naevi, and has no effect on the viability of normal cells or tissues [A32628]. |
Categories: Sulfur Compounds
Cross-references: BindingDB: 50366238 CHEMBL1961796 ChemSpider: 28487410 Wikipedia: SR9009