Molecule Details
| InChIKey | MGZKYOAQVGSSGC-DLBZAZTESA-N |
|---|---|
| Compound Name | Fisogatinib |
| Canonical SMILES | C=CC(=O)N[C@H]1CCOC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)ccc2n1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.9 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB16167 |
|---|---|
| Drug Name | Fisogatinib |
| CAS Number | 1707289-21-1 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Fisogatinib is under investigation in clinical trial NCT04194801 (A Phase Ib/ii Study of Fisogatinib(blu-554) in Subjects With Hepatocellular Carcinoma). |
Categories: Antineoplastic Agents Heterocyclic Compounds, Fused-Ring
Cross-references: ChemSpider: 58828666
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P22455 | FGFR4 | Homo sapiens | Human | PF07679 PF13927 PF07714 | 8.3 | IC50 | ChEMBL;BindingDB |
| P22607 | FGFR3 | Homo sapiens | Human | PF21165 PF07679 PF13927 PF07714 | 6.8 | IC50 | ChEMBL |
| P21802 | FGFR2 | Homo sapiens | Human | PF07679 PF13927 PF07714 | 6.3 | IC50 | ChEMBL |
| P11362 | FGFR1 | Homo sapiens | Human | PF07679 PF00047 PF07714 | 6.2 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P22455 | FGFR4 | Fibroblast growth factor receptor 4 | inhibitor | targets |