Molecule Details
| InChIKey | MFBCDACCJCDGBA-UHFFFAOYSA-N |
|---|---|
| Compound Name | Trifarotene |
| Canonical SMILES | CC(C)(C)c1cc(-c2cc(-c3ccc(C(=O)O)cc3)ccc2OCCO)ccc1N1CCCC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.61 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12808 |
|---|---|
| Drug Name | Trifarotene |
| CAS Number | 895542-09-3 |
| Groups | approved investigational |
| ATC Codes | D10AD06 |
| Description | Trifarotene is a topical retinoid cream used in the treatment of acne vulgaris that was first approved for use in the United States in October 2019.[L9013] Retinoids are a class of medications structurally and functionally analogous to [vitamin A], though later generation retinoids such as trifarote... |
Categories: Alkenes Anti-Acne Preparations Anti-Acne Preparations for Topical Use Cytochrome P-450 CYP2B6 Substrates Cytochrome P-450 CYP2C8 Substrates Cytochrome P-450 CYP2C9 Substrates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Substrates Dermatologicals Misc. Skin and Mucous Membrane Agents Polyenes Retinoids Retinoids for Topical Use in Acne
Cross-references: CHEMBL3707313 ChemSpider: 9693029 Drugs Product Database (DPD): 23388 PubChem:11518241 PubChem:347828982 RxCUI: 2205637 Wikipedia: Trifarotene
Target Activities (3)
DrugBank Target Actions (7)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P10632 | CYP2C8 | Cytochrome P450 2C8 | substrate | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | substrate | enzymes |
| P20813 | CYP2B6 | Cytochrome P450 2B6 | substrate | enzymes |
| P10276 | RARA | Retinoic acid receptor alpha | agonist | targets |
| P10826 | RARB | Retinoic acid receptor beta | agonist | targets |
| P13631 | RARG | Retinoic acid receptor gamma | agonist | targets |