Molecule Details
| InChIKey | MEKASOQEXYKAKM-UHFFFAOYSA-N |
|---|---|
| Compound Name | Ag-24322 |
| Canonical SMILES | CCNCc1cncc(-c2ccc3[nH]nc(-c4nc5c(F)cc(F)cc5[nH]4)c3c2)c1C |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.58 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13035 |
|---|---|
| Drug Name | AG-24322 |
| CAS Number | 837364-57-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | AG-024322 has been used in trials studying the treatment of Neoplasms and Lymphoma, Non-Hodgkin. |
Categories: CDC2 Protein Kinase, antagonists & inhibitors Cyclin-Dependent Kinase 2, antagonists & inhibitors Heterocyclic Compounds, Fused-Ring Pyrazoles
Cross-references: ChemSpider: 11253366 PubChem:6918834 PubChem:347829168 ZINC: ZINC000006718881
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P06493 | CDK1 | Homo sapiens | Human | PF00069 | 8.6 | IC50 | ChEMBL;BindingDB |
| P14635 | CCNB1 | Homo sapiens | Human | PF02984 PF00134 | 8.6 | IC50 | ChEMBL |
| P20248 | CCNA2 | Homo sapiens | Human | PF02984 PF00134 PF16500 | 8.5 | IC50 | ChEMBL |
| P24941 | CDK2 | Homo sapiens | Human | PF00069 | 8.5 | IC50 | ChEMBL;BindingDB |