Molecule Details
| InChIKey | MCYCODJKXUJSAT-UHFFFAOYSA-N |
|---|---|
| Compound Name | 2,5-Dimethoxy-4-ethylthioamphetamine |
| Canonical SMILES | CCSc1cc(OC)c(CC(C)N)cc1OC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 7 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.18 |
| Source | BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13940 |
|---|---|
| Drug Name | 2,5-Dimethoxy-4-ethylthioamphetamine |
| CAS Number | 185562-00-9 |
| Groups | experimental |
| ATC Codes | nan |
| Description | 2,5-Dimethoxy-4-ethylthioamphetamine (ALEPH-2) is a phenylisopropylamine derivative with alleged anxiolytic and hallucinogenic properties. |
Categories: Agents producing tachycardia Agents that produce hypertension Amines Amphetamines Antidepressive Agents Central Nervous System Depressants Ethylamines Phenethylamines Serotonergic Drugs Shown to Increase Risk of Serotonin Syndrome Serotonin 5-HT2 Receptor Agonists Serotonin Agents Serotonin Receptor Agonists Sympathomimetics
Cross-references: BindingDB: 50164337 CHEMBL339611 ChemSpider: 8439835
Target Activities (7)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P41595 | HTR2B | Homo sapiens | Human | PF00001 | 8.8 | Ki | BindingDB |
| P07550 | ADRB2 | Homo sapiens | Human | PF00001 | 7.6 | Ki | BindingDB |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 7.3 | Ki | BindingDB |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 7.2 | Ki | BindingDB |
| Q99720 | SIGMAR1 | Homo sapiens | Human | PF04622 | 6.6 | Ki | BindingDB |
| Q9Y2I1 | NISCH | Homo sapiens | Human | PF25625 PF23142 PF00787 | 6.5 | Ki | BindingDB |
| P23786 | CPT2 | Homo sapiens | Human | PF00755 | 6.2 | Ki | BindingDB |