Molecule Details
| InChIKey | MBWRLLRCTIYXDW-UHFFFAOYSA-N |
|---|---|
| Compound Name | H3b-6527 |
| Canonical SMILES | C=CC(=O)Nc1cc(N2CCN(CC)CC2)ccc1Nc1cc(N(C)C(=O)Nc2c(Cl)c(OC)cc(OC)c2Cl)ncn1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.77 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB15169 |
|---|---|
| Drug Name | H3B-6527 |
| CAS Number | 1702259-66-2 |
| Groups | investigational |
| ATC Codes | nan |
| Description | H3B-6527 is under investigation in clinical trial NCT03424577 (A Study to Evaluate the Food-Effect of H3B-6527). |
Categories: Heterocyclic Compounds, Fused-Ring
Cross-references: BindingDB: 249396 CHEMBL3939295 ChemSpider: 58172617 ZINC: ZINC000521836463
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P22455 | FGFR4 | Homo sapiens | Human | PF07679 PF13927 PF07714 | 7.8 | IC50 | ChEMBL;BindingDB |
| P11362 | FGFR1 | Homo sapiens | Human | PF07679 PF00047 PF07714 | 6.8 | IC50 | ChEMBL;BindingDB |
| P21802 | FGFR2 | Homo sapiens | Human | PF07679 PF13927 PF07714 | 6.2 | IC50 | ChEMBL;BindingDB |
| P22607 | FGFR3 | Homo sapiens | Human | PF21165 PF07679 PF13927 PF07714 | 6.2 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P22455 | FGFR4 | Fibroblast growth factor receptor 4 | inhibitor | targets |