Molecule Details
| InChIKey | MAOALPSHCIBFJZ-RUZDIDTESA-N |
|---|---|
| Canonical SMILES | Cn1c(CNc2ccc(C(=N)N)cc2)nc2cc([C@@](C)(NCC(=O)O)C(=O)N3CCCC3)ccc21 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.32 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21367 |
|---|---|
| Drug Name | Tanogitran |
| CAS Number | 637328-69-9 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Tanogitran is a small molecule drug. Tanogitran is under investigation in clinical trial NCT02254057 (Tolerability and Pharmacokinetics/-Dynamics of Single Rising Doses BIBT 986 BS in Healthy Male Subjects). Tanogitran has a monoisotopic molecular weight of 477.25 Da. |
Cross-references: BindingDB: 50328705 CHEMBL1270156 ZINC: ZINC000064527030
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P00742 | F10 | Coagulation factor X | inhibitor | targets |