Molecule Details
| InChIKey | LZCQFJKUAIWHRW-UHFFFAOYSA-N |
|---|---|
| Compound Name | Indolidan |
| Canonical SMILES | CC1(C)C(=O)Nc2ccc(C3=NNC(=O)CC3)cc21 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.1 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19499 |
|---|---|
| Drug Name | Indolidan |
| CAS Number | 100643-96-7 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Indolidan is a small molecule drug. The usage of the INN stem '-dan' in the name indicates that Indolidan is a cardiac stimulant, pimobendan derivative. Indolidan has a monoisotopic molecular weight of 257.12 Da. |
Categories: Alkaloids Heterocyclic Compounds, Fused-Ring Indole Alkaloids Indoles Indolizidines Indolizines
Cross-references: BindingDB: 50228246 CHEMBL38224 ZINC: ZINC000013544987
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P27815 | PDE4A | Homo sapiens | Human | PF18100 PF00233 | 7.1 | IC50 | ChEMBL |
| Q07343 | PDE4B | Homo sapiens | Human | PF18100 PF00233 | 7.1 | IC50 | ChEMBL;BindingDB |
| Q08493 | PDE4C | Homo sapiens | Human | PF18100 PF00233 | 7.1 | IC50 | ChEMBL |
| Q08499 | PDE4D | Homo sapiens | Human | PF18100 PF00233 | 7.1 | IC50 | ChEMBL |
| Q13370 | PDE3B | Homo sapiens | Human | PF00233 | 7.1 | IC50 | ChEMBL |
| Q14432 | PDE3A | Homo sapiens | Human | PF00233 | 7.1 | IC50 | ChEMBL;BindingDB |