Molecule Details
| InChIKey | LXZMHBHEXAELHH-UHFFFAOYSA-N |
|---|---|
| Compound Name | Clesacostat |
| Canonical SMILES | COc1cc(C(=O)N2CCC3(CC2)CC(=O)c2c(cnn2C(C)C)C3)cc(-c2ccc(C(=O)O)cc2)n1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.55 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB18956 |
|---|---|
| Drug Name | Clesacostat |
| CAS Number | 1370448-25-1 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Clesacostat is under investigation in clinical trial NCT04321031 (Metabolic Interventions to Resolve Non-alcoholic Steatohepatitis (NASH) With Fibrosis (MIRNA)). |
Cross-references: BindingDB: 50511112 CHEMBL4567446 ChemSpider: 114641970 ZINC: ZINC000114805174