Molecule Details
| InChIKey | LXBIFEVIBLOUGU-DPYQTVNSSA-N |
|---|---|
| Compound Name | Migalastat |
| Canonical SMILES | OC[C@H]1NC[C@H](O)[C@@H](O)[C@H]1O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.92 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB05018 |
|---|---|
| Drug Name | Migalastat |
| CAS Number | 108147-54-2 |
| Groups | approved investigational |
| ATC Codes | A16AX14 |
| Description | Fabry disease is a rare, progressive genetic disorder characterized by a defective GLA gene that causes a deficiency in the enzyme alpha-Galactosidase A (alpha-Gal A). This enzyme is responsible for breaking down glycosphingolipid substrate that, when deficient in patients with Fabry disease, builds... |
Categories: Alimentary Tract and Metabolism Alkaloids Alpha-Galactosidase A (alpha-Gal A) Pharmacological Chaperones Carbohydrates Drugs that are Mainly Renally Excreted Imino Pyranoses Imino Sugars Piperidines Various Alimentary Tract and Metabolism Products
Cross-references: BindingDB: 50163440 ChEBI: 135923 CHEMBL110458 ChemSpider: 153388 Drugs Product Database (DPD): 22894 PDB: DGJ PubChem:176077 PubChem:347827704 RxCUI: 2054252 Wikipedia: Migalastat ZINC: ZINC000001636704