Molecule Details
| InChIKey | LVRLSYPNFFBYCZ-VGWMRTNUSA-N |
|---|---|
| Compound Name | Omapatrilat |
| Canonical SMILES | O=C(N[C@H]1CCS[C@H]2CCC[C@@H](C(=O)O)N2C1=O)[C@@H](S)Cc1ccccc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.36 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00886 |
|---|---|
| Drug Name | Omapatrilat |
| CAS Number | 167305-00-2 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Omapatrilat is an investigational drug that inhibits both neutral endopeptidase (NEP) and angiotensin converting enzyme (ACE). The inhibition of NEP elevates natriuretic peptide levels, increasing excretion of sodium in urine, dilating blood vessels, and reducing preload and ventricular remodeling. ... |
Categories: Agents Acting on the Renin-Angiotensin System Agents causing angioedema Agents causing hyperkalemia Agents that produce hypertension Angiotensin-Converting Enzyme Inhibitors Antihypertensive Agents Azepines Cardiovascular Agents Enzyme Inhibitors Metalloendopeptidases, antagonists & inhibitors Protease Inhibitors Sulfur Compounds Thiepins Vasopeptidase Inhibitors
Cross-references: BindingDB: 50073120 ChEBI: 135660 CHEMBL289556 ChemSpider: 570983 D01970 PDB: FT8 PubChem:656629 PubChem:175426852 Wikipedia: Omapatrilat ZINC: ZINC000003809801