Molecule Details
| InChIKey | LSYANGLAZUZYFX-UHFFFAOYSA-N |
|---|---|
| Compound Name | Apinocaltamide |
| Canonical SMILES | N#Cc1ccc(Cn2ccc(NC(=O)Cc3ccc(C4(C(F)(F)F)CC4)cc3)n2)nc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.95 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB16241 |
|---|---|
| Drug Name | Apinocaltamide |
| CAS Number | 1838651-58-3 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Apinocaltamide is under investigation in clinical trial NCT03239691 (A Study to Evaluate the Effect of ACT-709478 in Photosensitive Epilepsy Patients). |
Categories: Acetates Acids, Acyclic Amides Antiarrhythmic agents Calcium Channel Blockers Calcium-Regulating Hormones and Agents Cardiovascular Agents Membrane Transport Modulators
Cross-references: BindingDB: 50452245 ChEBI: 194340 CHEMBL4217292 ChemSpider: 72379969 PDB: A1AHK