Molecule Details
| InChIKey | LSSUMOWDTKZHHT-UHFFFAOYSA-N |
|---|---|
| Compound Name | N,N-Diethyltryptamine |
| Canonical SMILES | CCN(CC)CCc1c[nH]c2ccccc12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.79 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01460 |
|---|---|
| Drug Name | Diethyltryptamine |
| CAS Number | 61-51-8 |
| Groups | experimental illicit |
| ATC Codes | nan |
| Description | Diethyltryptamine (DET) is an orally active hallucinogenic agent and a substituted form of tryptamine. |
Categories: Acids, Carbocyclic Agrochemicals Amides Amines Benzene Derivatives Benzoates Biogenic Amines Biogenic Monoamines Compounds used in a research, industrial, or household setting Heterocyclic Compounds, Fused-Ring Indoles Insect Repellents Pesticides Protective Agents Toxic Actions
Cross-references: BindingDB: 50094676 ChEBI: 184081 CHEMBL142936 ChemSpider: 5865 PubChem:6090 PubChem:46504638 Wikipedia: Diethyltryptamine ZINC: ZINC000001999162
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P50406 | HTR6 | 5-hydroxytryptamine receptor 6 | inhibitor | targets |