Molecule Details
| InChIKey | LPEPZBJOKDYZAD-UHFFFAOYSA-N |
|---|---|
| Compound Name | Flufenamic Acid |
| Canonical SMILES | O=C(O)c1ccccc1Nc1cccc(C(F)(F)F)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 7 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.31 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB02266 |
|---|---|
| Drug Name | Flufenamic acid |
| CAS Number | 530-78-9 |
| Groups | approved |
| ATC Codes | M01AG03 |
| Description | An anthranilic acid derivative with analgesic, anti-inflammatory, and antipyretic properties. It is used in musculoskeletal and joint disorders and administered by mouth and topically. (From Martindale, The Extra Pharmacopoeia, 30th ed, p16) |
Categories: Acids, Carbocyclic Aminobenzoates Anti-Inflammatory Agents Antiinflammatory and Antirheumatic Products Antiinflammatory and Antirheumatic Products, Non-Steroids Benzene Derivatives Benzoates Fenamates Musculo-Skeletal System OAT1/SLC22A6 inhibitors ortho-Aminobenzoates
Cross-references: BindingDB: 17636 ChEBI: 42638 CHEMBL23588 ChemSpider: 3254 Guide to Pharmacology: 2447 IUPHAR: 2447 C13038 D01581 PDB: FLF PharmGKB: PA166049190 PubChem:3371 PubChem:46507173 RxCUI: 4453 Wikipedia: Flufenamic_acid ZINC: ZINC000000086535
Target Activities (7)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q6XQN6 | NAPRT | Homo sapiens | Human | PF17956 PF17767 | 11.0 | Ki | ChEMBL |
| P35354 | PTGS2 | Homo sapiens | Human | PF03098 | 7.8 | IC50 | ChEMBL;BindingDB |
| P02766 | TTR | Homo sapiens | Human | PF00576 | 7.5 | Kd | ChEMBL;BindingDB |
| P42330 | AKR1C3 | Homo sapiens | Human | PF00248 | 6.4 | IC50 | ChEMBL;BindingDB |
| P52895 | AKR1C2 | Homo sapiens | Human | PF00248 | 6.4 | IC50 | ChEMBL;BindingDB |
| O60218 | AKR1B10 | Homo sapiens | Human | PF00248 | 6.1 | IC50 | ChEMBL;BindingDB |
| Q04828 | AKR1C1 | Homo sapiens | Human | PF00248 | 6.0 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (8)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02766 | TTR | Transthyretin | binder | carriers |
| Q07869 | PPARA | Peroxisome proliferator-activated receptor alpha | activator | targets |
| P37231 | PPARG | Peroxisome proliferator-activated receptor gamma | agonist | targets |
| P10275 | AR | Androgen receptor | inhibitor | targets |
| P23219 | PTGS1 | Prostaglandin G/H synthase 1 | inhibitor | targets |
| P35354 | PTGS2 | Prostaglandin G/H synthase 2 | inhibitor | targets |
| P42330 | AKR1C3 | Aldo-keto reductase family 1 member C3 | inhibitor | targets |
| Q4U2R8 | SLC22A6 | Solute carrier family 22 member 6 | inhibitor | transporters |