Molecule Details
| InChIKey | LMJFJIDLEAWOQJ-CQSZACIVSA-N |
|---|---|
| Compound Name | Azd-8186 |
| Canonical SMILES | C[C@@H](Nc1cc(F)cc(F)c1)c1cc(C(=O)N(C)C)cc2c(=O)cc(N3CCOCC3)oc12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.14 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB15029 |
|---|---|
| Drug Name | AZD-8186 |
| CAS Number | 1627494-13-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | AZD-8186 is under investigation in clinical trial NCT03218826 (PI3Kbeta Inhibitor AZD8186 and Docetaxel in Treating Patients Advanced Solid Tumors With PTEN or PIK3CB Mutations That Are Metastatic or Cannot Be Removed by Surgery). |
Categories: Amines Benzopyrans Heterocyclic Compounds, Fused-Ring Pyrans
Cross-references: BindingDB: 50070322 CHEMBL3408248 ChemSpider: 35000182 ZINC: ZINC000116734639
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P42338 | PIK3CB | Homo sapiens | Human | PF00454 PF00792 PF02192 PF00794 PF00613 | 8.5 | IC50 | ChEMBL;BindingDB |
| O00329 | PIK3CD | Homo sapiens | Human | PF00454 PF00792 PF02192 PF00794 PF00613 | 7.8 | IC50 | ChEMBL;BindingDB |
| P27986 | PIK3R1 | Homo sapiens | Human | PF16454 PF00620 PF00017 | 7.4 | IC50 | ChEMBL;BindingDB |
| P42336 | PIK3CA | Homo sapiens | Human | PF00454 PF00792 PF02192 PF00794 PF00613 | 6.9 | IC50 | ChEMBL;BindingDB |
| P48736 | PIK3CG | Homo sapiens | Human | PF00454 PF00792 PF00794 PF00613 PF19710 | 6.2 | IC50 | ChEMBL;BindingDB |
| Q02880 | TOP2B | Homo sapiens | Human | PF00204 PF00521 PF08070 PF02518 PF01751 PF16898 | 6.0 | Kd | ChEMBL |