Molecule Details
| InChIKey | LJJKNPQAGWVLDQ-SNVBAGLBSA-N |
|---|---|
| Compound Name | Thiorphan, (S)- |
| Canonical SMILES | O=C(O)CNC(=O)[C@@H](CS)Cc1ccccc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.82 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB08626 |
|---|---|
| Drug Name | Thiorphan |
| CAS Number | 76721-89-6 |
| Groups | experimental |
| ATC Codes | nan |
| Description | A potent inhibitor of membrane metalloendopeptidase (enkephalinase). Thiorphan potentiates morphine-induced analgesia and attenuates naloxone-precipitated withdrawal symptoms. |
Categories: Amino Acids Amino Acids, Peptides, and Proteins Amino Acids, Sulfur Enzyme Inhibitors N-substituted Glycines Protease Inhibitors Sulfur Compounds
Cross-references: BindingDB: 50024102 CHEMBL298827 ChemSpider: 3571959 C01619 PDB: TIO PubChem:4369380 PubChem:99445097 Wikipedia: Thiorphan ZINC: ZINC000003872336
Target Activities (3)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08473 | MME | Neprilysin | inhibitor | targets |