Molecule Details
| InChIKey | LDXYBEHACFJIEL-HNNXBMFYSA-N |
|---|---|
| Compound Name | Anagliptin |
| Canonical SMILES | Cc1cc2ncc(C(=O)NCC(C)(C)NCC(=O)N3CCC[C@H]3C#N)cn2n1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.6 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12417 |
|---|---|
| Drug Name | Anagliptin |
| CAS Number | 739366-20-2 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Anagliptin is under investigation for the treatment of LDL Cholesterol, Coronary Disease, Diabetes Mellitus, Glycosylated Hemoglobin, and Dipeptidyl-Peptidase 4 Inhibitors. |
Categories: Agents causing angioedema Blood Glucose Lowering Agents DPP-IV Inhibitors Enzyme Inhibitors Protease Inhibitors
Cross-references: BindingDB: 50359366 ChEBI: 136043 CHEMBL1929396 ChemSpider: 28492667 PDB: SKK PubChem:44513473 PubChem:347828661 Wikipedia: Anagliptin ZINC: ZINC000070647144
Target Activities (3)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P27487 | DPP4 | Dipeptidyl peptidase 4 | modulator | targets |