Molecule Details
| InChIKey | KYSFUHHFTIGRJN-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | CC1(NC2=NS(=O)(=O)c3sc(Cl)cc3N2)CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.52 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21402 |
|---|---|
| Drug Name | Tifenazoxide |
| CAS Number | 279215-43-9 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Tifenazoxide is a small molecule drug. Tifenazoxide is under investigation in clinical trial NCT04744129 (Headache Inducing Effect of NN414 in Migraine Patients). Tifenazoxide has a monoisotopic molecular weight of 290.99 Da. |
Categories: Sulfur Compounds
Cross-references: BindingDB: 50118359 CHEMBL135191 PDB: E2H ZINC: ZINC000000008767
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q09428 | ABCC8 | ATP-binding cassette sub-family C member 8 | modulator | targets |