Molecule Details
| InChIKey | KYDURMHFWXCKMW-UHFFFAOYSA-N |
|---|---|
| Compound Name | Azd-7325 |
| Canonical SMILES | CCCNC(=O)c1nnc2c(-c3c(F)cccc3OC)cccc2c1N |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.89 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13994 |
|---|---|
| Drug Name | AZD-7325 |
| CAS Number | 942437-37-8 |
| Groups | investigational |
| ATC Codes | nan |
| Description | AZD7325 is a high affinity, selective modulator of the GABAA receptor system. [L2936] |
Categories: GABA Modulators Heterocyclic Compounds, Fused-Ring
Cross-references: BindingDB: 50418481 CHEMBL1783282 ChemSpider: 26334679 ZINC: ZINC000071295104
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P18507 | GABRG2 | Homo sapiens | Human | PF02931 PF02932 | 9.5 | Ki | ChEMBL |
| P28472 | GABRB3 | Homo sapiens | Human | PF02931 PF02932 | 9.5 | Ki | ChEMBL |
| P47869 | GABRA2 | Homo sapiens | Human | PF02931 PF02932 | 9.5 | Ki | ChEMBL;BindingDB |
| P14867 | GABRA1 | Homo sapiens | Human | PF02931 PF02932 | 9.3 | Ki | ChEMBL;BindingDB |
| P34903 | GABRA3 | Homo sapiens | Human | PF02931 PF02932 | 8.9 | Ki | ChEMBL;BindingDB |
| P31644 | GABRA5 | Homo sapiens | Human | PF02931 PF02932 | 6.6 | Ki | ChEMBL;BindingDB |