Molecule Details
| InChIKey | KXVKOYCGACSUPP-INIZCTEOSA-N |
|---|---|
| Compound Name | PF-07038124 |
| Canonical SMILES | CCCOc1cc(-c2cncc([C@@H]3COB(O)C3)c2)ccc1OC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.59 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19143 |
|---|---|
| Drug Name | PF-07038124 |
| CAS Number | 2415085-44-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | PF-07038124 is under investigation in clinical trial NCT05298033 (Study of Efficacy, Safety and Tolerability of Crisaborole and PF-07038124 With and Without NBUVB in Vitiligo). |
Cross-references: ChemSpider: 115010212
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q07343 | PDE4B | Homo sapiens | Human | PF18100 PF00233 | 9.4 | IC50 | BindingDB |
| P25090 | FPR2 | Homo sapiens | Human | PF00001 | 9.3 | IC50 | ChEMBL |
| P15260 | IFNGR1 | Homo sapiens | Human | PF07140 PF20634 PF01108 | 9.0 | IC50 | BindingDB |
| P05112 | IL4 | Homo sapiens | Human | PF00727 | 8.4 | IC50 | BindingDB |
| P35225 | IL13 | Homo sapiens | Human | PF03487 | 6.9 | IC50 | BindingDB |