Molecule Details
| InChIKey | KWKZCGMJGHHOKJ-WTIHWRCNSA-N |
|---|---|
| Compound Name | methyl (S)-(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraen-1-ylphosphonofluoridate |
| Canonical SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC[P@@](=O)(F)OC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.54 |
| Source | BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB02465 |
|---|---|
| Drug Name | Methoxy arachidonyl fluorophosphonate |
| CAS Number | 180509-15-3 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Methoxy arachidonyl fluorophosphonate, commonly referred as MAFP, is an irreversible active site-directed enzyme inhibitor that inhibits nearly all serine hydrolases and serine proteases. It inhibits phospholipase A2 and fatty acid amide hydrolase with special potency, displaying IC50 values in the ... |
Categories: Eicosanoids Enzyme Inhibitors Fatty Acids Fatty Acids, Essential Fatty Acids, Unsaturated Lipids Organophosphorus Compounds Phospholipases A, antagonists & inhibitors
Cross-references: ChemSpider: 59053894 PDB: MAY PubChem:92536013 PubChem:46504573 Wikipedia: Methoxy_arachidonyl_fluorophosphonate ZINC: ZINC000017654246
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| O00519 | FAAH | Homo sapiens | Human | PF01425 | 9.2 | IC50 | BindingDB |
| Q99685 | MGLL | Homo sapiens | Human | PF12146 | 7.6 | IC50 | BindingDB |
| P68402 | PAFAH1B2 | Homo sapiens | Human | PF13472 | 7.1 | IC50 | BindingDB |
| P47712 | PLA2G4A | Homo sapiens | Human | PF00168 PF01735 | 6.2 | IC50 | BindingDB |