Molecule Details
| InChIKey | KWEFZSZCLBHIEQ-YYADALCUSA-N |
|---|---|
| Compound Name | (1E)-5-(1-piperidin-4-yl-3-pyridin-4-yl-1H-pyrazol-4-yl)-2,3-dihydro-1H-inden-1-one oxime |
| Canonical SMILES | O/N=C1\CCc2cc(-c3cn(C4CCNCC4)nc3-c3ccncc3)ccc21 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.87 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB08553 |
|---|---|
| Drug Name | (1E)-5-(1-piperidin-4-yl-3-pyridin-4-yl-1H-pyrazol-4-yl)-2,3-dihydro-1H-inden-1-one oxime |
| CAS Number | nan |
| Groups | experimental |
| ATC Codes | nan |
| Description | (1E)-5-(1-piperidin-4-yl-3-pyridin-4-yl-1h-pyrazol-4-yl)-2,3-dihydro-1h-inden-1-one oxime is a solid. This compound belongs to the phenylpyrazoles. These are compounds containing a phenylpyrazole skeleton, which consists of a pyrazole bound to a phenyl group. It targets the protein serine/threonine-... |
Cross-references: BindingDB: 50006650 CHEMBL526479 ChemSpider: 9828390 PDB: SM5 PubChem:11653652 PubChem:99445024 ZINC: ZINC000039110119
Target Activities (3)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P15056 | BRAF | Serine/threonine-protein kinase B-raf | binder | targets |