Molecule Details
| InChIKey | KVLFRAWTRWDEDF-IRXDYDNUSA-N |
|---|---|
| Compound Name | Azd8055 |
| Canonical SMILES | COc1ccc(-c2ccc3c(N4CCOC[C@@H]4C)nc(N4CCOC[C@@H]4C)nc3n2)cc1CO |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.67 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12774 |
|---|---|
| Drug Name | AZD-8055 |
| CAS Number | 1009298-09-2 |
| Groups | investigational |
| ATC Codes | nan |
| Description | AZD8055 has been used in trials studying the treatment of Cancer, Lymphomas, Solid Tumors, MALIGNANT GLIOMA, and brainstem glioma, among others. |
Categories: Oxazines mTOR Inhibitors
Cross-references: BindingDB: 50348452 ChEBI: 91329 CHEMBL1801204 ChemSpider: 24747394 PubChem:25262965 PubChem:347828957 ZINC: ZINC000052509466
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P42345 | MTOR | Homo sapiens | Human | PF02259 PF02260 PF08771 PF23593 PF11865 PF00454 | 9.1 | IC50 | ChEMBL;BindingDB |
| Q9BVC4 | MLST8 | Homo sapiens | Human | PF00400 | 8.8 | IC50 | ChEMBL;BindingDB |
| Q6R327 | RICTOR | Homo sapiens | Human | PF14663 PF14666 PF14664 PF14665 PF14668 | 8.6 | IC50 | ChEMBL |
| Q9BPZ7 | MAPKAP1 | Homo sapiens | Human | PF16978 PF25322 PF05422 PF16979 | 8.6 | IC50 | ChEMBL;BindingDB |
| Q8N122 | RPTOR | Homo sapiens | Human | PF02985 PF14538 PF00400 | 8.3 | IC50 | ChEMBL |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P42345 | MTOR | Serine/threonine-protein kinase mTOR | inhibitor | targets |