Molecule Details
| InChIKey | KTDZCOWXCWUPEO-UHFFFAOYSA-N |
|---|---|
| Compound Name | N-(2-(Cyclohexyloxy)-4-nitrophenyl)methanesulfonamide |
| Canonical SMILES | CS(=O)(=O)Nc1ccc([N+](=O)[O-])cc1OC1CCCCC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.49 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB14060 |
|---|---|
| Drug Name | NS-398 |
| CAS Number | 123653-11-2 |
| Groups | experimental |
| ATC Codes | nan |
| Description | NS-398 is a COX-2 inhibitor. It was developed as part of the mechanistic study of the cyclooxygenases. |
Categories: Agents causing hyperkalemia Agents that produce hypertension Amides Analgesics Analgesics, Non-Narcotic Anti-Inflammatory Agents Anti-Inflammatory Agents, Non-Steroidal Antirheumatic Agents Benzene Derivatives Cyclooxygenase Inhibitors Enzyme Inhibitors Nephrotoxic agents Nitro Compounds Peripheral Nervous System Agents Sensory System Agents Sulfones Sulfur Compounds
Cross-references: BindingDB: 50029593 ChEBI: 73458 CHEMBL7162 ChemSpider: 4393 PDB: NS4 PharmGKB: PA166049196 Wikipedia: NS-398 ZINC: ZINC000003791739