Molecule Details
| InChIKey | KSGCNXAZROJSNW-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | CCS(=O)(=O)c1ccc2oc(-c3ccc4ccccc4c3)nc2c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.79 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12888 |
|---|---|
| Drug Name | Ezutromid |
| CAS Number | 945531-77-1 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Ezutromid has been investigated for the treatment of Muscular Dystrophy, Duchenne. |
Categories: Heterocyclic Compounds, Fused-Ring Muscular Dystrophy, Duchenne
Cross-references: BindingDB: 50519636 CHEMBL1773683 ChemSpider: 26344547 PubChem:25109292 PubChem:347829043 Wikipedia: Ezutromid ZINC: ZINC000071297091
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P46939 | P46939 | Utrophin | upregulator | targets |