Molecule Details
| InChIKey | KSERXGMCDHOLSS-LJQANCHMSA-N |
|---|---|
| Compound Name | Ulixertinib |
| Canonical SMILES | CC(C)Nc1cc(-c2c[nH]c(C(=O)N[C@H](CO)c3cccc(Cl)c3)c2)c(Cl)cn1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.07 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13930 |
|---|---|
| Drug Name | Ulixertinib |
| CAS Number | 869886-67-9 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Ulixertinib is a a novel, reversible, ATP-competitive ERK1/2 inhibitor with high potency and ERK1/2 selectivity [A31474]. It is currently in clinical trials for the treatment of a wide range of tumors. |
Categories: Amines Pyridines
Cross-references: CHEMBL3590106 ChemSpider: 9893722 PDB: EVK ZINC: ZINC000034642570