Molecule Details
| InChIKey | KPYSYYIEGFHWSV-QMMMGPOBSA-N |
|---|---|
| Compound Name | Arbaclofen |
| Canonical SMILES | NC[C@H](CC(=O)O)c1ccc(Cl)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.82 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB08891 |
|---|---|
| Drug Name | Arbaclofen |
| CAS Number | 69308-37-8 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Arbaclofen, or STX209, is the R-enantiomer of baclofen. It is believed to be a selective gamma-amino butyric acid type B receptor agonist, and has been investigated as a treatment for autism spectrum disorder and fragile X syndrome in randomized, double blind, placebo controlled trials. It has also ... |
Cross-references: BindingDB: 50032964 CHEMBL301742 ChemSpider: 40580 PDB: 2C0 PubChem:44602 PubChem:347827809 Wikipedia: Arbaclofen_placarbil ZINC: ZINC000000000061