Molecule Details
| InChIKey | KORCWPOBTZTAFI-YVTYUBGGSA-N |
|---|---|
| Canonical SMILES | OC[C@H]1O[C@@H](c2cc(Cc3ccc(C4CC4)cc3)c(Cl)c3c2CCO3)[C@H](O)[C@@H](O)[C@@H]1O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.89 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB18970 |
|---|---|
| Drug Name | Enavogliflozin |
| CAS Number | 1415472-28-4 |
| Groups | investigational |
| ATC Codes | A10BK09 |
| Description | Enavogliflozin is under investigation in clinical trial NCT06399835 (Enavogliflozin vs. Pioglitazone on Glucose and Atherosclerosis). |
Categories: Alimentary Tract and Metabolism Blood Glucose Lowering Agents Diuretics Drugs Used in Diabetes Heterocyclic Compounds, Fused-Ring Sodium-glucose Cotransporter 2 (SGLT2) Inhibitors
Cross-references: BindingDB: 159529 CHEMBL3703921 ChemSpider: 58891640 Wikipedia: Enavogliflozin ZINC: ZINC000206062649