Molecule Details
| InChIKey | KOHUFVUIYUCFNG-PHDIDXHHSA-N |
|---|---|
| Compound Name | Qpx7728 |
| Canonical SMILES | O=C(O)c1c(F)ccc2c1OB(O)[C@@H]1C[C@H]21 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.67 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21512 |
|---|---|
| Drug Name | Xeruborbactam |
| CAS Number | 2170834-63-4 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Xeruborbactam is a small molecule drug. The usage of the INN stem '-bactam' in the name indicates that Xeruborbactam is a ẞ-lactamase inhibitor. Xeruborbactam is under investigation in clinical trial NCT07104162 (A Study to Investigate Safety and Pharmacokinetics of Intravenous Cefiderocol/Xeruborba... |
Categories: Acids Acids, Noncarboxylic Anti-Bacterial Agents Anti-Infective Agents Boron Compounds Enzyme Inhibitors beta-Lactamase Inhibitors
Cross-references: BindingDB: 50541448 CHEMBL4633785 PDB: RM9
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q9L4P2 | OXA-23 | Acinetobacter baumannii | Pathogen | PF00905 | 9.1 | Ki | ChEMBL;BindingDB |
| A8DS27 | blaKPC-2 | Escherichia coli | Pathogen | PF13354 | 8.7 | Ki | ChEMBL |
| Q848S6 | bla | Klebsiella oxytoca | Pathogen | PF13354 | 8.7 | Ki | BindingDB |
| Q5GN09 | vim-1 | Klebsiella pneumoniae | Pathogen | PF00753 | 8.1 | Ki | BindingDB |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P00807 | blaZ | Beta-lactamase | inhibitor | targets |