Molecule Details
| InChIKey | KLPWJLBORRMFGK-UHFFFAOYSA-N |
|---|---|
| Compound Name | Molindone |
| Canonical SMILES | CCc1c(C)[nH]c2c1C(=O)C(CN1CCOCC1)CC2 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 8 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.94 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01618 |
|---|---|
| Drug Name | Molindone |
| CAS Number | 7416-34-4 |
| Groups | approved |
| ATC Codes | N05AE02 |
| Description | An indole derivative effective in schizophrenia and other psychoses and possibly useful in the treatment of the aggressive type of undersocialized conduct disorder. Molindone has much lower affinity for D2 receptors than most antipsychotic agents and has a relatively low affinity for D1 receptors. I... |
Categories: Antidepressive Agents Antipsychotic Agents Antipsychotic Agents (First Generation [Typical]) Central Nervous System Agents Central Nervous System Depressants Dopamine Antagonists Dopamine D2 Receptor Antagonists Heterocyclic Compounds, Fused-Ring Indole Derivatives Indoles Nervous System Neurotoxic agents Psycholeptics Psychotropic Drugs Serotonin 5-HT1 Receptor Antagonists Serotonin 5-HT1A Receptor Antagonists Serotonin 5-HT2 Receptor Antagonists Serotonin 5-HT2A Receptor Antagonists Serotonin Agents Serotonin Receptor Antagonists Tranquilizing Agents
Cross-references: BindingDB: 50130290 ChEBI: 6965 CHEMBL460 ChemSpider: 22342 Guide to Pharmacology: 207 IUPHAR: 207 C07230 D08226 PharmGKB: PA164746756 PubChem:23897 PubChem:46504744 RxCUI: 7019 Therapeutic Targets Database: DAP000979 Wikipedia: Molindone
Target Activities (8)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P21917 | DRD4 | Homo sapiens | Human | PF00001 | 8.2 | Ki | BindingDB |
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 7.7 | Ki | BindingDB |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 7.3 | Ki | BindingDB |
| P18825 | ADRA2C | Homo sapiens | Human | PF00001 | 6.8 | Ki | BindingDB |
| P34969 | HTR7 | Homo sapiens | Human | PF00001 | 6.6 | Ki | ChEMBL;BindingDB |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 6.5 | Ki | BindingDB |
| P18089 | ADRA2B | Homo sapiens | Human | PF00001 | 6.2 | Ki | BindingDB |
| P08913 | ADRA2A | Homo sapiens | Human | PF00001 | 6.2 | Ki | BindingDB |